About 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one
6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one (PubChem CID 139020593) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one.
Molecular Properties
| Compound Name | 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one |
| PubChem CID | 139020593 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one |
| SMILES | Cc1nn(CCCOc2cccc3ccccc23)c(C)c1C1CCCC(=O)N1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-23(20-11-6-13-22(27)24-20)17(2)26(25-16)14-7-15-28-21-12-5-9-18-8-3-4-10-19(18)21/h3-5,8-10,12,20H,6-7,11,13-15H2,1-2H3,(H,24,27) |
| InChIKey | GTSFCUJTYWUFBV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one?
The IUPAC name of 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one (CID 139020593) is 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one.
What is the SMILES notation for 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one?
The canonical SMILES for 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one is Cc1nn(CCCOc2cccc3ccccc23)c(C)c1C1CCCC(=O)N1.
What is the InChIKey of 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one?
The InChIKey is GTSFCUJTYWUFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-16-23(20-11-6-13-22(27)24-20)17(2)26(25-16)14-7-15-28-21-12-5-9-18-8-3-4-10-19(18)21/h3-5,8-10,12,20H,6-7,11,13-15H2,1-2H3,(H,24,27).
What are the key properties of 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one?
6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one has a molecular weight of 377.49 g/mol, XLogP of 4.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3,5-dimethyl-1-(3-naphthalen-1-yloxypropyl)pyrazol-4-yl]piperidin-2-one is sourced from PubChem (CID 139020593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).