About methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate
methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate (PubChem CID 139020627) has the molecular formula C13H18N2O5
and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate |
| PubChem CID | 139020627 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN2C[C@H](O)C[C@H]2C(N)=O)oc1C |
| InChI | InChI=1S/C13H18N2O5/c1-7-10(13(18)19-2)4-9(20-7)6-15-5-8(16)3-11(15)12(14)17/h4,8,11,16H,3,5-6H2,1-2H3,(H2,14,17)/t8-,11+/m1/s1 |
| InChIKey | CEUBKWIBGLJNIO-KCJUWKMLSA-N |
| XLogP | -0.20 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate?
The IUPAC name of methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate (CID 139020627) is methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate.
What is the SMILES notation for methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate?
The canonical SMILES for methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate is COC(=O)c1cc(CN2C[C@H](O)C[C@H]2C(N)=O)oc1C.
What is the InChIKey of methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate?
The InChIKey is CEUBKWIBGLJNIO-KCJUWKMLSA-N. The full InChI is InChI=1S/C13H18N2O5/c1-7-10(13(18)19-2)4-9(20-7)6-15-5-8(16)3-11(15)12(14)17/h4,8,11,16H,3,5-6H2,1-2H3,(H2,14,17)/t8-,11+/m1/s1.
What are the key properties of methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate?
methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate has a molecular weight of 282.30 g/mol, XLogP of -0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[(2S,4R)-2-carbamoyl-4-hydroxypyrrolidin-1-yl]methyl]-2-methylfuran-3-carboxylate is sourced from PubChem (CID 139020627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).