C20H26N4O — CID 139020823
1-[(3S)-1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone (PubChem CID 139020823) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[(3S)-1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone.
| Compound Name | 1-[(3S)-1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 139020823 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-[(3S)-1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanone |
| SMILES | C[C@H]1CN(C)c2ccccc2CN1C(=O)Cc1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C20H26N4O/c1-14-12-23(2)19-10-6-3-7-15(19)13-24(14)20(25)11-18-16-8-4-5-9-17(16)21-22-18/h3,6-7,10,14H,4-5,8-9,11-13H2,1-2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | UVPHWEWNARVOQR-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |