C14H18ClNO3S — CID 139020959
(3aS,6R,6aR)-1-(5-chloro-2-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-ol (PubChem CID 139020959) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is (3aS,6R,6aR)-1-(5-chloro-2-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-ol.
| Compound Name | (3aS,6R,6aR)-1-(5-chloro-2-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-ol |
|---|---|
| PubChem CID | 139020959 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (3aS,6R,6aR)-1-(5-chloro-2-methylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-ol |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N1CC[C@@H]2CC[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C14H18ClNO3S/c1-9-2-4-11(15)8-13(9)20(18,19)16-7-6-10-3-5-12(17)14(10)16/h2,4,8,10,12,14,17H,3,5-7H2,1H3/t10-,12+,14+/m0/s1 |
| InChIKey | YHRZWIJRPGYDRO-ZKYQVNSYSA-N |
| XLogP | 2.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |