C19H32BNO4 — CID 139021283
[(2S,3S)-3-propan-2-yloxolan-2-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 139021283) has the molecular formula C19H32BNO4 and a molecular weight of 349.28 g/mol. Its IUPAC name is [(2S,3S)-3-propan-2-yloxolan-2-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | [(2S,3S)-3-propan-2-yloxolan-2-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 139021283 |
| Molecular Formula | C19H32BNO4 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | [(2S,3S)-3-propan-2-yloxolan-2-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | CC(C)[C@@H]1CCO[C@@H]1C(=O)N1CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C19H32BNO4/c1-13(2)15-9-12-23-16(15)17(22)21-10-7-14(8-11-21)20-24-18(3,4)19(5,6)25-20/h7,13,15-16H,8-12H2,1-6H3/t15-,16-/m0/s1 |
| InChIKey | NWAUNPGQVBQHMF-HOTGVXAUSA-N |
| XLogP | 2.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|