C18H26BF2N3O3 — CID 139021288
[5-(difluoromethyl)-1,3-dimethylpyrazol-4-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 139021288) has the molecular formula C18H26BF2N3O3 and a molecular weight of 381.23 g/mol. Its IUPAC name is [5-(difluoromethyl)-1,3-dimethylpyrazol-4-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | [5-(difluoromethyl)-1,3-dimethylpyrazol-4-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 139021288 |
| Molecular Formula | C18H26BF2N3O3 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | [5-(difluoromethyl)-1,3-dimethylpyrazol-4-yl]-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | Cc1nn(C)c(C(F)F)c1C(=O)N1CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C18H26BF2N3O3/c1-11-13(14(15(20)21)23(6)22-11)16(25)24-9-7-12(8-10-24)19-26-17(2,3)18(4,5)27-19/h7,15H,8-10H2,1-6H3 |
| InChIKey | MGCRKTSPRMTDMF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|