C19H27BN2O4 — CID 139021312
2-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethyl]benzamide (PubChem CID 139021312) has the molecular formula C19H27BN2O4 and a molecular weight of 358.25 g/mol. Its IUPAC name is 2-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethyl]benzamide.
| Compound Name | 2-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 139021312 |
| Molecular Formula | C19H27BN2O4 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethyl]benzamide |
| SMILES | CC1(C)OB(C2CCN(C(=O)Cc3ccccc3C(N)=O)C2)OC1(C)C |
| InChI | InChI=1S/C19H27BN2O4/c1-18(2)19(3,4)26-20(25-18)14-9-10-22(12-14)16(23)11-13-7-5-6-8-15(13)17(21)24/h5-8,14H,9-12H2,1-4H3,(H2,21,24) |
| InChIKey | WTFSKIUBRCJNOM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|