C17H30BN3O4 — CID 139021336
3,3-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]piperazin-2-one (PubChem CID 139021336) has the molecular formula C17H30BN3O4 and a molecular weight of 351.26 g/mol. Its IUPAC name is 3,3-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]piperazin-2-one.
| Compound Name | 3,3-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 139021336 |
| Molecular Formula | C17H30BN3O4 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 3,3-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]piperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C(=O)N1CCC(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C17H30BN3O4/c1-15(2)13(22)19-8-10-21(15)14(23)20-9-7-12(11-20)18-24-16(3,4)17(5,6)25-18/h12H,7-11H2,1-6H3,(H,19,22) |
| InChIKey | UXVWNCBNHPQJPL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|