C14H19F3N4 — CID 139021549
(3aS,7aS)-5-methyl-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 139021549) has the molecular formula C14H19F3N4 and a molecular weight of 300.33 g/mol. Its IUPAC name is (3aS,7aS)-5-methyl-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | (3aS,7aS)-5-methyl-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 139021549 |
| Molecular Formula | C14H19F3N4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3aS,7aS)-5-methyl-2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | Cc1cc(C(F)(F)F)nc(N2C[C@H]3CCN(C)C[C@H]3C2)n1 |
| InChI | InChI=1S/C14H19F3N4/c1-9-5-12(14(15,16)17)19-13(18-9)21-7-10-3-4-20(2)6-11(10)8-21/h5,10-11H,3-4,6-8H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | RLDJCRCZUNZTBH-MNOVXSKESA-N |
| XLogP | 2.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |