About 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid
4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid (PubChem CID 139021849) has the molecular formula C14H16ClNO4S
and a molecular weight of 329.81 g/mol. Its IUPAC name is 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid.
Molecular Properties
| Compound Name | 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid |
| PubChem CID | 139021849 |
| Molecular Formula | C14H16ClNO4S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC2CCC[C@@H]3C[C@H]23)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClNO4S/c15-11-7-9(14(17)18)4-5-13(11)21(19,20)16-12-3-1-2-8-6-10(8)12/h4-5,7-8,10,12,16H,1-3,6H2,(H,17,18)/t8-,10+,12?/m1/s1 |
| InChIKey | SNYQMFAOQYHNFZ-RWPGAEDHSA-N |
| XLogP | 2.51 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid?
The IUPAC name of 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid (CID 139021849) is 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid.
What is the SMILES notation for 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid?
The canonical SMILES for 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid is O=C(O)c1ccc(S(=O)(=O)NC2CCC[C@@H]3C[C@H]23)c(Cl)c1.
What is the InChIKey of 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid?
The InChIKey is SNYQMFAOQYHNFZ-RWPGAEDHSA-N. The full InChI is InChI=1S/C14H16ClNO4S/c15-11-7-9(14(17)18)4-5-13(11)21(19,20)16-12-3-1-2-8-6-10(8)12/h4-5,7-8,10,12,16H,1-3,6H2,(H,17,18)/t8-,10+,12?/m1/s1.
What are the key properties of 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid?
4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid has a molecular weight of 329.81 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S,6R)-2-bicyclo[4.1.0]heptanyl]sulfamoyl]-3-chlorobenzoic acid is sourced from PubChem (CID 139021849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).