C15H20N4OS — CID 139021980
[(3R,8aS)-2-(5-methylthieno[2,3-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]methanol (PubChem CID 139021980) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is [(3R,8aS)-2-(5-methylthieno[2,3-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]methanol.
| Compound Name | [(3R,8aS)-2-(5-methylthieno[2,3-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]methanol |
|---|---|
| PubChem CID | 139021980 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [(3R,8aS)-2-(5-methylthieno[2,3-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]methanol |
| SMILES | Cc1csc2ncnc(N3C[C@@H]4CCCN4C[C@@H]3CO)c12 |
| InChI | InChI=1S/C15H20N4OS/c1-10-8-21-15-13(10)14(16-9-17-15)19-6-11-3-2-4-18(11)5-12(19)7-20/h8-9,11-12,20H,2-7H2,1H3/t11-,12+/m0/s1 |
| InChIKey | NIDXJBRHDQWKPO-NWDGAFQWSA-N |
| XLogP | 1.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |