C17H21ClFN3O3 — CID 139022122
2-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-N-(prop-2-enylcarbamoyl)propanamide (PubChem CID 139022122) has the molecular formula C17H21ClFN3O3 and a molecular weight of 369.82 g/mol. Its IUPAC name is 2-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-N-(prop-2-enylcarbamoyl)propanamide.
| Compound Name | 2-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-N-(prop-2-enylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 139022122 |
| Molecular Formula | C17H21ClFN3O3 |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[[(2S,3R)-2-(4-chloro-3-fluorophenyl)oxolan-3-yl]amino]-N-(prop-2-enylcarbamoyl)propanamide |
| SMILES | C=CCNC(=O)NC(=O)C(C)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C17H21ClFN3O3/c1-3-7-20-17(24)22-16(23)10(2)21-14-6-8-25-15(14)11-4-5-12(18)13(19)9-11/h3-5,9-10,14-15,21H,1,6-8H2,2H3,(H2,20,22,23,24)/t10?,14-,15+/m1/s1 |
| InChIKey | FIOAXTQUGUZWTI-YJWLYOEVSA-N |
| XLogP | 2.30 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|