About 2-chloro-4-methyl-1,3-oxazole;hydrochloride
2-chloro-4-methyl-1,3-oxazole;hydrochloride (PubChem CID 139022515) has the molecular formula C4H5Cl2NO
and a molecular weight of 154.00 g/mol. Its IUPAC name is 2-chloro-4-methyl-1,3-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-1,3-oxazole;hydrochloride |
| PubChem CID | 139022515 |
| Molecular Formula | C4H5Cl2NO |
| Molecular Weight | 154.00 g/mol |
| Exact Mass | 152.97 |
| IUPAC Name | 2-chloro-4-methyl-1,3-oxazole;hydrochloride |
| SMILES | Cc1coc(Cl)n1.Cl |
| InChI | InChI=1S/C4H4ClNO.ClH/c1-3-2-7-4(5)6-3;/h2H,1H3;1H |
| InChIKey | OFBPPWRDXRWTEB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.00 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-methyl-1,3-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-1,3-oxazole;hydrochloride?
The IUPAC name of 2-chloro-4-methyl-1,3-oxazole;hydrochloride (CID 139022515) is 2-chloro-4-methyl-1,3-oxazole;hydrochloride.
What is the SMILES notation for 2-chloro-4-methyl-1,3-oxazole;hydrochloride?
The canonical SMILES for 2-chloro-4-methyl-1,3-oxazole;hydrochloride is Cc1coc(Cl)n1.Cl.
What is the InChIKey of 2-chloro-4-methyl-1,3-oxazole;hydrochloride?
The InChIKey is OFBPPWRDXRWTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClNO.ClH/c1-3-2-7-4(5)6-3;/h2H,1H3;1H.
What are the key properties of 2-chloro-4-methyl-1,3-oxazole;hydrochloride?
2-chloro-4-methyl-1,3-oxazole;hydrochloride has a molecular weight of 154.00 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-1,3-oxazole;hydrochloride is sourced from PubChem (CID 139022515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).