5-bromo-2,4-dimethylbenzenesulfonyl fluoride

C8H8BrFO2S — CID 139022539

IUPAC5-bromo-2,4-dimethylbenzenesulfonyl fluoride
SMILESCc1cc(C)c(S(=O)(=O)F)cc1Br
InChIInChI=1S/C8H8BrFO2S/c1-5-3-6(2)8(4-7(5)9)13(10,11)12/h3-4H,1-2H3
InChIKeyXMHUJSGFLFXZKX-UHFFFAOYSA-N
MW267.12 g/mol
LogP2.72
Rot. Bonds1

About 5-bromo-2,4-dimethylbenzenesulfonyl fluoride

5-bromo-2,4-dimethylbenzenesulfonyl fluoride (PubChem CID 139022539) has the molecular formula C8H8BrFO2S and a molecular weight of 267.12 g/mol. Its IUPAC name is 5-bromo-2,4-dimethylbenzenesulfonyl fluoride.

Molecular Properties

Compound Name5-bromo-2,4-dimethylbenzenesulfonyl fluoride
PubChem CID139022539
Molecular FormulaC8H8BrFO2S
Molecular Weight267.12 g/mol
Exact Mass265.94
IUPAC Name5-bromo-2,4-dimethylbenzenesulfonyl fluoride
SMILESCc1cc(C)c(S(=O)(=O)F)cc1Br
InChIInChI=1S/C8H8BrFO2S/c1-5-3-6(2)8(4-7(5)9)13(10,11)12/h3-4H,1-2H3
InChIKeyXMHUJSGFLFXZKX-UHFFFAOYSA-N
XLogP2.72
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.12
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 5-bromo-2,4-dimethylbenzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2,4-dimethylbenzenesulfonyl fluoride?
The IUPAC name of 5-bromo-2,4-dimethylbenzenesulfonyl fluoride (CID 139022539) is 5-bromo-2,4-dimethylbenzenesulfonyl fluoride.
What is the SMILES notation for 5-bromo-2,4-dimethylbenzenesulfonyl fluoride?
The canonical SMILES for 5-bromo-2,4-dimethylbenzenesulfonyl fluoride is Cc1cc(C)c(S(=O)(=O)F)cc1Br.
What is the InChIKey of 5-bromo-2,4-dimethylbenzenesulfonyl fluoride?
The InChIKey is XMHUJSGFLFXZKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrFO2S/c1-5-3-6(2)8(4-7(5)9)13(10,11)12/h3-4H,1-2H3.
What are the key properties of 5-bromo-2,4-dimethylbenzenesulfonyl fluoride?
5-bromo-2,4-dimethylbenzenesulfonyl fluoride has a molecular weight of 267.12 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-dimethylbenzenesulfonyl fluoride is sourced from PubChem (CID 139022539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).