About 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride
2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride (PubChem CID 139022705) has the molecular formula C7H11Cl2N3O2
and a molecular weight of 240.09 g/mol. Its IUPAC name is 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride |
| PubChem CID | 139022705 |
| Molecular Formula | C7H11Cl2N3O2 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(Cc1cncnc1)C(=O)O |
| InChI | InChI=1S/C7H9N3O2.2ClH/c8-6(7(11)12)1-5-2-9-4-10-3-5;;/h2-4,6H,1,8H2,(H,11,12);2*1H |
| InChIKey | HIYXKMYRENHAOP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride?
The IUPAC name of 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride (CID 139022705) is 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride.
What is the SMILES notation for 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride?
The canonical SMILES for 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride is Cl.Cl.NC(Cc1cncnc1)C(=O)O.
What is the InChIKey of 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride?
The InChIKey is HIYXKMYRENHAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2.2ClH/c8-6(7(11)12)1-5-2-9-4-10-3-5;;/h2-4,6H,1,8H2,(H,11,12);2*1H.
What are the key properties of 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride?
2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride has a molecular weight of 240.09 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride is sourced from PubChem (CID 139022705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).