C22H24O4 — CID 139025829
2-[(10S,13S,16S)-17-hydroxy-10,13,16-trimethyl-3-oxo-7,12,15,16-tetrahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoacetaldehyde (PubChem CID 139025829) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-[(10S,13S,16S)-17-hydroxy-10,13,16-trimethyl-3-oxo-7,12,15,16-tetrahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[(10S,13S,16S)-17-hydroxy-10,13,16-trimethyl-3-oxo-7,12,15,16-tetrahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 139025829 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[(10S,13S,16S)-17-hydroxy-10,13,16-trimethyl-3-oxo-7,12,15,16-tetrahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoacetaldehyde |
| SMILES | C[C@H]1CC2=C3CCC4=CC(=O)C=C[C@]4(C)C3=CC[C@]2(C)C1(O)C(=O)C=O |
| InChI | InChI=1S/C22H24O4/c1-13-10-18-16-5-4-14-11-15(24)6-8-20(14,2)17(16)7-9-21(18,3)22(13,26)19(25)12-23/h6-8,11-13,26H,4-5,9-10H2,1-3H3/t13-,20-,21-,22?/m0/s1 |
| InChIKey | RSQLXODNFBIJHK-WPUNKPILSA-N |
| XLogP | 3.02 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|