C15H17O4P — CID 139025846
1,1,1,2,3,3,3-heptadeuteriopropan-2-yl diphenyl phosphate (PubChem CID 139025846) has the molecular formula C15H17O4P and a molecular weight of 299.31 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl diphenyl phosphate.
| Compound Name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl diphenyl phosphate |
|---|---|
| PubChem CID | 139025846 |
| Molecular Formula | C15H17O4P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl diphenyl phosphate |
| SMILES | [2H]C([2H])([2H])C([2H])(OP(=O)(Oc1ccccc1)Oc1ccccc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H17O4P/c1-13(2)17-20(16,18-14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h3-13H,1-2H3/i1D3,2D3,13D |
| InChIKey | YDICVVYPXSZSFA-GYDXGMDDSA-N |
| XLogP | 4.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|