C19H20O4S — CID 139026147
[(3E)-3-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl] methanesulfonate (PubChem CID 139026147) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is [(3E)-3-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl] methanesulfonate.
| Compound Name | [(3E)-3-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl] methanesulfonate |
|---|---|
| PubChem CID | 139026147 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [(3E)-3-(9-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC/C=C1\c2ccccc2CC(O)c2ccccc21 |
| InChI | InChI=1S/C19H20O4S/c1-24(21,22)23-12-6-11-16-15-8-3-2-7-14(15)13-19(20)18-10-5-4-9-17(16)18/h2-5,7-11,19-20H,6,12-13H2,1H3/b16-11+ |
| InChIKey | KDMMWEQUIOANOP-LFIBNONCSA-N |
| XLogP | 3.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|