C8H12ClN3O2 — CID 139026448
1,5,6,7,8,9-hexahydropyrimido[4,5-c]azepine-2,4-dione;hydrochloride (PubChem CID 139026448) has the molecular formula C8H12ClN3O2 and a molecular weight of 217.66 g/mol. Its IUPAC name is 1,5,6,7,8,9-hexahydropyrimido[4,5-c]azepine-2,4-dione;hydrochloride.
| Compound Name | 1,5,6,7,8,9-hexahydropyrimido[4,5-c]azepine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 139026448 |
| Molecular Formula | C8H12ClN3O2 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1,5,6,7,8,9-hexahydropyrimido[4,5-c]azepine-2,4-dione;hydrochloride |
| SMILES | Cl.O=c1[nH]c2c(c(=O)[nH]1)CCCNC2 |
| InChI | InChI=1S/C8H11N3O2.ClH/c12-7-5-2-1-3-9-4-6(5)10-8(13)11-7;/h9H,1-4H2,(H2,10,11,12,13);1H |
| InChIKey | RXNCVRPRVISZLY-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |