About 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide
4-(Piperazin-1-yl)pyridin-2-ol hydrobromide (PubChem CID 139026493) has the molecular formula C9H14BrN3O
and a molecular weight of 260.13 g/mol. Its IUPAC name is 4-piperazin-1-yl-1H-pyridin-2-one;hydrobromide.
Molecular Properties
| Compound Name | 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide |
| PubChem CID | 139026493 |
| Molecular Formula | C9H14BrN3O |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 4-piperazin-1-yl-1H-pyridin-2-one;hydrobromide |
| SMILES | C1CN(CCN1)C2=CC(=O)NC=C2.Br |
| InChI | InChI=1S/C9H13N3O.BrH/c13-9-7-8(1-2-11-9)12-5-3-10-4-6-12;/h1-2,7,10H,3-6H2,(H,11,13);1H |
| InChIKey | NIVVHDAKBXFTBK-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 44.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 264 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide?
The IUPAC name of 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide (CID 139026493) is 4-piperazin-1-yl-1H-pyridin-2-one;hydrobromide.
What is the SMILES notation for 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide?
The canonical SMILES for 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide is C1CN(CCN1)C2=CC(=O)NC=C2.Br.
What is the InChIKey of 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide?
The InChIKey is NIVVHDAKBXFTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O.BrH/c13-9-7-8(1-2-11-9)12-5-3-10-4-6-12;/h1-2,7,10H,3-6H2,(H,11,13);1H.
What are the key properties of 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide?
4-(Piperazin-1-yl)pyridin-2-ol hydrobromide has a molecular weight of 260.13 g/mol, XLogP of not available, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(Piperazin-1-yl)pyridin-2-ol hydrobromide is sourced from PubChem (CID 139026493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).