About (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride
(8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride (PubChem CID 139026796) has the molecular formula C9H18ClNO2
and a molecular weight of 207.70 g/mol. Its IUPAC name is (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride.
Molecular Properties
| Compound Name | (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride |
| PubChem CID | 139026796 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride |
| SMILES | Cl.O[C@@H]1CNC2(CCCC2)C[C@@H]1O |
| InChI | InChI=1S/C9H17NO2.ClH/c11-7-5-9(3-1-2-4-9)10-6-8(7)12;/h7-8,10-12H,1-6H2;1H/t7-,8+;/m0./s1 |
| InChIKey | HEPYDZAPQYXBIR-KZYPOYLOSA-N |
| XLogP | 0.44 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride?
The IUPAC name of (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride (CID 139026796) is (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride.
What is the SMILES notation for (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride?
The canonical SMILES for (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride is Cl.O[C@@H]1CNC2(CCCC2)C[C@@H]1O.
What is the InChIKey of (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride?
The InChIKey is HEPYDZAPQYXBIR-KZYPOYLOSA-N. The full InChI is InChI=1S/C9H17NO2.ClH/c11-7-5-9(3-1-2-4-9)10-6-8(7)12;/h7-8,10-12H,1-6H2;1H/t7-,8+;/m0./s1.
What are the key properties of (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride?
(8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8R,9S)-6-azaspiro[4.5]decane-8,9-diol;hydrochloride is sourced from PubChem (CID 139026796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).