About 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride
2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride (PubChem CID 139026799) has the molecular formula C7H17Cl3N2O2S
and a molecular weight of 299.65 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride |
| PubChem CID | 139026799 |
| Molecular Formula | C7H17Cl3N2O2S |
| Molecular Weight | 299.65 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride |
| SMILES | CN1CCN(CCS(=O)(=O)Cl)CC1.Cl.Cl |
| InChI | InChI=1S/C7H15ClN2O2S.2ClH/c1-9-2-4-10(5-3-9)6-7-13(8,11)12;;/h2-7H2,1H3;2*1H |
| InChIKey | WUEJHOUNLMEMKL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.65 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride?
The IUPAC name of 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride (CID 139026799) is 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride.
What is the SMILES notation for 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride?
The canonical SMILES for 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride is CN1CCN(CCS(=O)(=O)Cl)CC1.Cl.Cl.
What is the InChIKey of 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride?
The InChIKey is WUEJHOUNLMEMKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15ClN2O2S.2ClH/c1-9-2-4-10(5-3-9)6-7-13(8,11)12;;/h2-7H2,1H3;2*1H.
What are the key properties of 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride?
2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride has a molecular weight of 299.65 g/mol, XLogP of 0.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpiperazin-1-yl)ethanesulfonyl chloride;dihydrochloride is sourced from PubChem (CID 139026799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).