About 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine
5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine (PubChem CID 139026808) has the molecular formula C8H8BrN3
and a molecular weight of 226.08 g/mol. Its IUPAC name is 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine |
| PubChem CID | 139026808 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine |
| SMILES | Cc1nc(Br)cc2cn(C)nc12 |
| InChI | InChI=1S/C8H8BrN3/c1-5-8-6(3-7(9)10-5)4-12(2)11-8/h3-4H,1-2H3 |
| InChIKey | ZSUSHPWBPHRRTN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine?
The IUPAC name of 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine (CID 139026808) is 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine.
What is the SMILES notation for 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine?
The canonical SMILES for 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine is Cc1nc(Br)cc2cn(C)nc12.
What is the InChIKey of 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine?
The InChIKey is ZSUSHPWBPHRRTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN3/c1-5-8-6(3-7(9)10-5)4-12(2)11-8/h3-4H,1-2H3.
What are the key properties of 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine?
5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine has a molecular weight of 226.08 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,7-dimethylpyrazolo[3,4-c]pyridine is sourced from PubChem (CID 139026808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).