C6H5F5O2 — CID 139026820
(E)-4,4,5,5,5-pentafluoro-3-methylpent-2-enoic acid (PubChem CID 139026820) has the molecular formula C6H5F5O2 and a molecular weight of 204.09 g/mol. Its IUPAC name is (E)-4,4,5,5,5-pentafluoro-3-methylpent-2-enoic acid.
| Compound Name | (E)-4,4,5,5,5-pentafluoro-3-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 139026820 |
| Molecular Formula | C6H5F5O2 |
| Molecular Weight | 204.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | (E)-4,4,5,5,5-pentafluoro-3-methylpent-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F5O2/c1-3(2-4(12)13)5(7,8)6(9,10)11/h2H,1H3,(H,12,13)/b3-2+ |
| InChIKey | AIMGIZANJZSIPW-NSCUHMNNSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|