About 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one
3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one (PubChem CID 139026850) has the molecular formula C9H17NOS2
and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one |
| PubChem CID | 139026850 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one |
| SMILES | CSCCC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C9H17NOS2/c1-12-7-3-9(11)10-4-2-6-13-8-5-10/h2-8H2,1H3 |
| InChIKey | QQIDSGRJDOPPOT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one?
The IUPAC name of 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one (CID 139026850) is 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one.
What is the SMILES notation for 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one?
The canonical SMILES for 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one is CSCCC(=O)N1CCCSCC1.
What is the InChIKey of 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one?
The InChIKey is QQIDSGRJDOPPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NOS2/c1-12-7-3-9(11)10-4-2-6-13-8-5-10/h2-8H2,1H3.
What are the key properties of 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one?
3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one has a molecular weight of 219.37 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanyl-1-(1,4-thiazepan-4-yl)propan-1-one is sourced from PubChem (CID 139026850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).