C14H17N3O2S2 — CID 139027098
5-[4-(benzenesulfonyl)piperidin-1-yl]-3-methyl-1,2,4-thiadiazole (PubChem CID 139027098) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-[4-(benzenesulfonyl)piperidin-1-yl]-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-[4-(benzenesulfonyl)piperidin-1-yl]-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 139027098 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-[4-(benzenesulfonyl)piperidin-1-yl]-3-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(N2CCC(S(=O)(=O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-11-15-14(20-16-11)17-9-7-13(8-10-17)21(18,19)12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3 |
| InChIKey | RZZVUOZHTQNUOC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |