C17H14ClN5O2 — CID 139027620
6-(4-chlorophenyl)-2-[1-(1H-pyrazole-5-carbonyl)azetidin-3-yl]pyridazin-3-one (PubChem CID 139027620) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-[1-(1H-pyrazole-5-carbonyl)azetidin-3-yl]pyridazin-3-one.
| Compound Name | 6-(4-chlorophenyl)-2-[1-(1H-pyrazole-5-carbonyl)azetidin-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 139027620 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-(4-chlorophenyl)-2-[1-(1H-pyrazole-5-carbonyl)azetidin-3-yl]pyridazin-3-one |
| SMILES | O=C(c1ccn[nH]1)N1CC(n2nc(-c3ccc(Cl)cc3)ccc2=O)C1 |
| InChI | InChI=1S/C17H14ClN5O2/c18-12-3-1-11(2-4-12)14-5-6-16(24)23(21-14)13-9-22(10-13)17(25)15-7-8-19-20-15/h1-8,13H,9-10H2,(H,19,20) |
| InChIKey | UGSJNUUGBCNARA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |