C13H16N2OS — CID 139028527
(3-methylidene-8-azabicyclo[3.2.1]octan-8-yl)-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 139028527) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is (3-methylidene-8-azabicyclo[3.2.1]octan-8-yl)-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | (3-methylidene-8-azabicyclo[3.2.1]octan-8-yl)-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 139028527 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (3-methylidene-8-azabicyclo[3.2.1]octan-8-yl)-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | C=C1CC2CCC(C1)N2C(=O)c1csc(C)n1 |
| InChI | InChI=1S/C13H16N2OS/c1-8-5-10-3-4-11(6-8)15(10)13(16)12-7-17-9(2)14-12/h7,10-11H,1,3-6H2,2H3 |
| InChIKey | MHPWTMVULYACPT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|