C11H14N6S2 — CID 139029558
6-(5-methyl-1H-pyrazol-3-yl)-3-(propylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 139029558) has the molecular formula C11H14N6S2 and a molecular weight of 294.41 g/mol. Its IUPAC name is 6-(5-methyl-1H-pyrazol-3-yl)-3-(propylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(5-methyl-1H-pyrazol-3-yl)-3-(propylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 139029558 |
| Molecular Formula | C11H14N6S2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6-(5-methyl-1H-pyrazol-3-yl)-3-(propylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CCCSCc1nnc2sc(-c3cc(C)[nH]n3)nn12 |
| InChI | InChI=1S/C11H14N6S2/c1-3-4-18-6-9-14-15-11-17(9)16-10(19-11)8-5-7(2)12-13-8/h5H,3-4,6H2,1-2H3,(H,12,13) |
| InChIKey | XHQMCTDQVAWPSV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|