C14H17N3O2S — CID 139030148
4-[(E)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol (PubChem CID 139030148) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-[(E)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol.
| Compound Name | 4-[(E)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 139030148 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-[(E)-[(4,5-dimethyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(/C=N/Nc2nc(C)c(C)s2)ccc1O |
| InChI | InChI=1S/C14H17N3O2S/c1-4-19-13-7-11(5-6-12(13)18)8-15-17-14-16-9(2)10(3)20-14/h5-8,18H,4H2,1-3H3,(H,16,17)/b15-8+ |
| InChIKey | HVAHTXGVNLVXMC-OVCLIPMQSA-N |
| XLogP | 3.31 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|