C12H24O2Si — CID 139030244
(6Z)-2,2-di(propan-2-yl)-4,5,8,9-tetrahydro-1,3,2-dioxasilonine (PubChem CID 139030244) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is (6Z)-2,2-di(propan-2-yl)-4,5,8,9-tetrahydro-1,3,2-dioxasilonine.
| Compound Name | (6Z)-2,2-di(propan-2-yl)-4,5,8,9-tetrahydro-1,3,2-dioxasilonine |
|---|---|
| PubChem CID | 139030244 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (6Z)-2,2-di(propan-2-yl)-4,5,8,9-tetrahydro-1,3,2-dioxasilonine |
| SMILES | CC(C)[Si]1(C(C)C)OCC/C=C\CCO1 |
| InChI | InChI=1S/C12H24O2Si/c1-11(2)15(12(3)4)13-9-7-5-6-8-10-14-15/h5-6,11-12H,7-10H2,1-4H3/b6-5- |
| InChIKey | ZAJGAXQLMDOTJJ-WAYWQWQTSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|