C7H14O2Si — CID 139030245
(6Z)-2,2-dimethyl-5,8-dihydro-4H-1,3,2-dioxasilocine (PubChem CID 139030245) has the molecular formula C7H14O2Si and a molecular weight of 158.27 g/mol. Its IUPAC name is (6Z)-2,2-dimethyl-5,8-dihydro-4H-1,3,2-dioxasilocine.
| Compound Name | (6Z)-2,2-dimethyl-5,8-dihydro-4H-1,3,2-dioxasilocine |
|---|---|
| PubChem CID | 139030245 |
| Molecular Formula | C7H14O2Si |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | (6Z)-2,2-dimethyl-5,8-dihydro-4H-1,3,2-dioxasilocine |
| SMILES | C[Si]1(C)OC/C=C\CCO1 |
| InChI | InChI=1S/C7H14O2Si/c1-10(2)8-6-4-3-5-7-9-10/h3-4H,5-7H2,1-2H3/b4-3- |
| InChIKey | WMEBXWSOZATROH-ARJAWSKDSA-N |
| XLogP | 1.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|