About methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate
methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate (PubChem CID 139030405) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate |
| PubChem CID | 139030405 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate |
| SMILES | CCCCC1=C(/C=C/C(=O)OC)c2ccccc2CC1 |
| InChI | InChI=1S/C18H22O2/c1-3-4-7-14-10-11-15-8-5-6-9-16(15)17(14)12-13-18(19)20-2/h5-6,8-9,12-13H,3-4,7,10-11H2,1-2H3/b13-12+ |
| InChIKey | CWBMBRDJRZUYFI-OUKQBFOZSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate?
The IUPAC name of methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate (CID 139030405) is methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate?
The canonical SMILES for methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate is CCCCC1=C(/C=C/C(=O)OC)c2ccccc2CC1.
What is the InChIKey of methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate?
The InChIKey is CWBMBRDJRZUYFI-OUKQBFOZSA-N. The full InChI is InChI=1S/C18H22O2/c1-3-4-7-14-10-11-15-8-5-6-9-16(15)17(14)12-13-18(19)20-2/h5-6,8-9,12-13H,3-4,7,10-11H2,1-2H3/b13-12+.
What are the key properties of methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate?
methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate has a molecular weight of 270.37 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(2-butyl-3,4-dihydronaphthalen-1-yl)prop-2-enoate is sourced from PubChem (CID 139030405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).