C12H19NO — CID 139030414
N,N-diethylbicyclo[2.2.1]hept-2-ene-2-carboxamide (PubChem CID 139030414) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N,N-diethylbicyclo[2.2.1]hept-2-ene-2-carboxamide.
| Compound Name | N,N-diethylbicyclo[2.2.1]hept-2-ene-2-carboxamide |
|---|---|
| PubChem CID | 139030414 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N,N-diethylbicyclo[2.2.1]hept-2-ene-2-carboxamide |
| SMILES | CCN(CC)C(=O)C1=CC2CCC1C2 |
| InChI | InChI=1S/C12H19NO/c1-3-13(4-2)12(14)11-8-9-5-6-10(11)7-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | GPWQBASXTWUBDU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |