About 2-butylpyrazolo[1,5-a]quinoxalin-4-amine
2-butylpyrazolo[1,5-a]quinoxalin-4-amine (PubChem CID 139030521) has the molecular formula C14H16N4
and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-butylpyrazolo[1,5-a]quinoxalin-4-amine.
Molecular Properties
| Compound Name | 2-butylpyrazolo[1,5-a]quinoxalin-4-amine |
| PubChem CID | 139030521 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-butylpyrazolo[1,5-a]quinoxalin-4-amine |
| SMILES | CCCCc1cc2c(N)nc3ccccc3n2n1 |
| InChI | InChI=1S/C14H16N4/c1-2-3-6-10-9-13-14(15)16-11-7-4-5-8-12(11)18(13)17-10/h4-5,7-9H,2-3,6H2,1H3,(H2,15,16) |
| InChIKey | YMNPLUINBRDMEW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butylpyrazolo[1,5-a]quinoxalin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylpyrazolo[1,5-a]quinoxalin-4-amine?
The IUPAC name of 2-butylpyrazolo[1,5-a]quinoxalin-4-amine (CID 139030521) is 2-butylpyrazolo[1,5-a]quinoxalin-4-amine.
What is the SMILES notation for 2-butylpyrazolo[1,5-a]quinoxalin-4-amine?
The canonical SMILES for 2-butylpyrazolo[1,5-a]quinoxalin-4-amine is CCCCc1cc2c(N)nc3ccccc3n2n1.
What is the InChIKey of 2-butylpyrazolo[1,5-a]quinoxalin-4-amine?
The InChIKey is YMNPLUINBRDMEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4/c1-2-3-6-10-9-13-14(15)16-11-7-4-5-8-12(11)18(13)17-10/h4-5,7-9H,2-3,6H2,1H3,(H2,15,16).
What are the key properties of 2-butylpyrazolo[1,5-a]quinoxalin-4-amine?
2-butylpyrazolo[1,5-a]quinoxalin-4-amine has a molecular weight of 240.31 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylpyrazolo[1,5-a]quinoxalin-4-amine is sourced from PubChem (CID 139030521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).