C7H11IN2 — CID 139030563
1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide (PubChem CID 139030563) has the molecular formula C7H11IN2 and a molecular weight of 250.08 g/mol. Its IUPAC name is 1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide.
| Compound Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide |
|---|---|
| PubChem CID | 139030563 |
| Molecular Formula | C7H11IN2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide |
| SMILES | C1=CCN2CC[NH2+]C2=C1.[I-] |
| InChI | InChI=1S/C7H10N2.HI/c1-2-5-9-6-4-8-7(9)3-1;/h1-3,8H,4-6H2;1H |
| InChIKey | SFLBMXJHCMDXCR-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|