C8H12I2N2 — CID 139030578
2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide (PubChem CID 139030578) has the molecular formula C8H12I2N2 and a molecular weight of 390.01 g/mol. Its IUPAC name is 2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide.
| Compound Name | 2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide |
|---|---|
| PubChem CID | 139030578 |
| Molecular Formula | C8H12I2N2 |
| Molecular Weight | 390.01 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridin-1-ium iodide |
| SMILES | ICC1CN2CC=CC=C2[NH2+]1.[I-] |
| InChI | InChI=1S/C8H11IN2.HI/c9-5-7-6-11-4-2-1-3-8(11)10-7;/h1-3,7,10H,4-6H2;1H |
| InChIKey | SNZPIHBJUWPIPB-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.01 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|