C8H11IN2 — CID 139030579
2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 139030579) has the molecular formula C8H11IN2 and a molecular weight of 262.09 g/mol. Its IUPAC name is 2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 139030579 |
| Molecular Formula | C8H11IN2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-(iodomethyl)-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | ICC1CN2CC=CC=C2N1 |
| InChI | InChI=1S/C8H11IN2/c9-5-7-6-11-4-2-1-3-8(11)10-7/h1-3,7,10H,4-6H2 |
| InChIKey | QAPNXGMVSCEAEZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|