About N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine
N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine (PubChem CID 139030585) has the molecular formula C7H22N5P
and a molecular weight of 207.26 g/mol. Its IUPAC name is N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine.
Molecular Properties
| Compound Name | N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine |
| PubChem CID | 139030585 |
| Molecular Formula | C7H22N5P |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine |
| SMILES | CNN=P(N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C7H22N5P/c1-8-9-13(10(2)3,11(4)5)12(6)7/h8H,1-7H3 |
| InChIKey | YZFPGMUPLDBKRM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine?
The IUPAC name of N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine (CID 139030585) is N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine.
What is the SMILES notation for N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine?
The canonical SMILES for N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine is CNN=P(N(C)C)(N(C)C)N(C)C.
What is the InChIKey of N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine?
The InChIKey is YZFPGMUPLDBKRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H22N5P/c1-8-9-13(10(2)3,11(4)5)12(6)7/h8H,1-7H3.
What are the key properties of N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine?
N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine has a molecular weight of 207.26 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[tris(dimethylamino)-λ5-phosphanylidene]amino]methanamine is sourced from PubChem (CID 139030585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).