C14H27NO2S2 — CID 139030641
6-cyclohexyl-1,11-dioxa-4,8-dithia-6-azacyclotridecane (PubChem CID 139030641) has the molecular formula C14H27NO2S2 and a molecular weight of 305.51 g/mol. Its IUPAC name is 6-cyclohexyl-1,11-dioxa-4,8-dithia-6-azacyclotridecane.
| Compound Name | 6-cyclohexyl-1,11-dioxa-4,8-dithia-6-azacyclotridecane |
|---|---|
| PubChem CID | 139030641 |
| Molecular Formula | C14H27NO2S2 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 6-cyclohexyl-1,11-dioxa-4,8-dithia-6-azacyclotridecane |
| SMILES | C1CCC(N2CSCCOCCOCCSC2)CC1 |
| InChI | InChI=1S/C14H27NO2S2/c1-2-4-14(5-3-1)15-12-18-10-8-16-6-7-17-9-11-19-13-15/h14H,1-13H2 |
| InChIKey | CLXLIAMAWCUJSU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |