C18H19N5O4S — CID 139030788
N'-hydroxy-4-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-thiadiazol-5-yl]amino]benzenecarboximidamide (PubChem CID 139030788) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is N'-hydroxy-4-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-thiadiazol-5-yl]amino]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-thiadiazol-5-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 139030788 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N'-hydroxy-4-[[3-(3,4,5-trimethoxyphenyl)-1,2,4-thiadiazol-5-yl]amino]benzenecarboximidamide |
| SMILES | COc1cc(-c2nsc(Nc3ccc(/C(N)=N\O)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N5O4S/c1-25-13-8-11(9-14(26-2)15(13)27-3)17-21-18(28-23-17)20-12-6-4-10(5-7-12)16(19)22-24/h4-9,24H,1-3H3,(H2,19,22)(H,20,21,23) |
| InChIKey | LQPVGYRIFYYWFA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|