C26H42N2O — CID 139030801
(2E,4E,6E,8E)-N-(6-aminohexyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 139030801) has the molecular formula C26H42N2O and a molecular weight of 398.64 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(6-aminohexyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(6-aminohexyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 139030801 |
| Molecular Formula | C26H42N2O |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | (2E,4E,6E,8E)-N-(6-aminohexyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NCCCCCCN)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H42N2O/c1-21(15-16-24-23(3)14-11-17-26(24,4)5)12-10-13-22(2)20-25(29)28-19-9-7-6-8-18-27/h10,12-13,15-16,20H,6-9,11,14,17-19,27H2,1-5H3,(H,28,29)/b13-10+,16-15+,21-12+,22-20+ |
| InChIKey | JLIZAOGFAANWLQ-CICHKUIQSA-N |
| XLogP | 6.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|