About oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium
oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium (PubChem CID 139031922) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium.
Molecular Properties
| Compound Name | oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium |
| PubChem CID | 139031922 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium |
| SMILES | CCCC=CCC=CC=CC=NN[NH2+][O-] |
| InChI | InChI=1S/C11H19N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15/h4-5,7-11,13H,2-3,6,14H2,1H3 |
| InChIKey | DQMOSRDZWQSBHC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium?
The IUPAC name of oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium (CID 139031922) is oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium.
What is the SMILES notation for oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium?
The canonical SMILES for oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium is CCCC=CCC=CC=CC=NN[NH2+][O-].
What is the InChIKey of oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium?
The InChIKey is DQMOSRDZWQSBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15/h4-5,7-11,13H,2-3,6,14H2,1H3.
What are the key properties of oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium?
oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium has a molecular weight of 209.29 g/mol, XLogP of 1.40, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxido-(2-undeca-2,4,7-trienylidenehydrazinyl)azanium is sourced from PubChem (CID 139031922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).