C24H26N4O10 — CID 139033176
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[2-[5-[(4-hydroxyphenyl)carbamoylamino]oxadiazol-3-ium-3-yl]propyl]phenoxy]oxane-2-carboxylate (PubChem CID 139033176) has the molecular formula C24H26N4O10 and a molecular weight of 530.49 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[2-[5-[(4-hydroxyphenyl)carbamoylamino]oxadiazol-3-ium-3-yl]propyl]phenoxy]oxane-2-carboxylate.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[2-[5-[(4-hydroxyphenyl)carbamoylamino]oxadiazol-3-ium-3-yl]propyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 139033176 |
| Molecular Formula | C24H26N4O10 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[2-[5-[(4-hydroxyphenyl)carbamoylamino]oxadiazol-3-ium-3-yl]propyl]phenoxy]oxane-2-carboxylate |
| SMILES | CC(Cc1ccc(O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)cc1)[n+]1cc(NC(=O)Nc2ccc(O)cc2)on1 |
| InChI | InChI=1S/C24H25N4O10/c1-12(28-11-17(38-27-28)26-24(35)25-14-4-6-15(29)7-5-14)10-13-2-8-16(9-3-13)36-23-20(32)18(30)19(31)21(37-23)22(33)34/h2-9,11-12,18-21,23,30-32H,10H2,1H3,(H2,26,33,34,35)/q-1/p+1/t12?,18-,19-,20+,21-,23+/m0/s1 |
| InChIKey | WTUJCHZJAQXNKF-WOFGHVAPSA-O |
| XLogP | -0.95 |
| TPSA | 210.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|