About iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene
iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 139033544) has the molecular formula C10H16Ir
and a molecular weight of 328.46 g/mol. Its IUPAC name is iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
Analyze iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene?
The IUPAC name of iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (CID 139033544) is iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
What is the SMILES notation for iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene?
The canonical SMILES for iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene is CC1=C(C)C(C)C(C)=C1C.[Ir].
What is the InChIKey of iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene?
The InChIKey is GUDZHAATOCWCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.Ir/c1-6-7(2)9(4)10(5)8(6)3;/h6H,1-5H3;.
What are the key properties of iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene?
iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene has a molecular weight of 328.46 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene is sourced from PubChem (CID 139033544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).