3-amino-2-fluoroprop-2-enoic acid

C3H4FNO2 — CID 139034655

IUPAC3-amino-2-fluoroprop-2-enoic acid
SMILESNC=C(F)C(=O)O
InChIInChI=1S/C3H4FNO2/c4-2(1-5)3(6)7/h1H,5H2,(H,6,7)
InChIKeyUJCYIQDCUVFMQJ-UHFFFAOYSA-N
MW105.07 g/mol
LogP-0.16
Rot. Bonds1

About 3-amino-2-fluoroprop-2-enoic acid

3-amino-2-fluoroprop-2-enoic acid (PubChem CID 139034655) has the molecular formula C3H4FNO2 and a molecular weight of 105.07 g/mol. Its IUPAC name is 3-amino-2-fluoroprop-2-enoic acid.

Molecular Properties

Compound Name3-amino-2-fluoroprop-2-enoic acid
PubChem CID139034655
Molecular FormulaC3H4FNO2
Molecular Weight105.07 g/mol
Exact Mass105.02
IUPAC Name3-amino-2-fluoroprop-2-enoic acid
SMILESNC=C(F)C(=O)O
InChIInChI=1S/C3H4FNO2/c4-2(1-5)3(6)7/h1H,5H2,(H,6,7)
InChIKeyUJCYIQDCUVFMQJ-UHFFFAOYSA-N
XLogP-0.16
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500105.07
LogP ≤ 5-0.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-amino-2-fluoroprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-fluoroprop-2-enoic acid?
The IUPAC name of 3-amino-2-fluoroprop-2-enoic acid (CID 139034655) is 3-amino-2-fluoroprop-2-enoic acid.
What is the SMILES notation for 3-amino-2-fluoroprop-2-enoic acid?
The canonical SMILES for 3-amino-2-fluoroprop-2-enoic acid is NC=C(F)C(=O)O.
What is the InChIKey of 3-amino-2-fluoroprop-2-enoic acid?
The InChIKey is UJCYIQDCUVFMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4FNO2/c4-2(1-5)3(6)7/h1H,5H2,(H,6,7).
What are the key properties of 3-amino-2-fluoroprop-2-enoic acid?
3-amino-2-fluoroprop-2-enoic acid has a molecular weight of 105.07 g/mol, XLogP of -0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-fluoroprop-2-enoic acid is sourced from PubChem (CID 139034655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).