C8H10BrClN2 — CID 139035179
7-bromo-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride (PubChem CID 139035179) has the molecular formula C8H10BrClN2 and a molecular weight of 249.54 g/mol. Its IUPAC name is 7-bromo-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride.
| Compound Name | 7-bromo-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 139035179 |
| Molecular Formula | C8H10BrClN2 |
| Molecular Weight | 249.54 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 7-bromo-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride |
| SMILES | Brc1cc2c(cn1)CCNC2.Cl |
| InChI | InChI=1S/C8H9BrN2.ClH/c9-8-3-7-4-10-2-1-6(7)5-11-8;/h3,5,10H,1-2,4H2;1H |
| InChIKey | QDOCJJNYCORFSI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|