About dipotassium;2-tert-butylbenzene-1,4-diolate
dipotassium;2-tert-butylbenzene-1,4-diolate (PubChem CID 139035525) has the molecular formula C10H12K2O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is dipotassium;2-tert-butylbenzene-1,4-diolate.
Molecular Properties
| Compound Name | dipotassium;2-tert-butylbenzene-1,4-diolate |
| PubChem CID | 139035525 |
| Molecular Formula | C10H12K2O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | dipotassium;2-tert-butylbenzene-1,4-diolate |
| SMILES | CC(C)(C)c1cc([O-])ccc1[O-].[K+].[K+] |
| InChI | InChI=1S/C10H14O2.2K/c1-10(2,3)8-6-7(11)4-5-9(8)12;;/h4-6,11-12H,1-3H3;;/q;2*+1/p-2 |
| InChIKey | SKJDFBPMLZPEGR-UHFFFAOYSA-L |
| XLogP | -4.86 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dipotassium;2-tert-butylbenzene-1,4-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-tert-butylbenzene-1,4-diolate?
The IUPAC name of dipotassium;2-tert-butylbenzene-1,4-diolate (CID 139035525) is dipotassium;2-tert-butylbenzene-1,4-diolate.
What is the SMILES notation for dipotassium;2-tert-butylbenzene-1,4-diolate?
The canonical SMILES for dipotassium;2-tert-butylbenzene-1,4-diolate is CC(C)(C)c1cc([O-])ccc1[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-tert-butylbenzene-1,4-diolate?
The InChIKey is SKJDFBPMLZPEGR-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H14O2.2K/c1-10(2,3)8-6-7(11)4-5-9(8)12;;/h4-6,11-12H,1-3H3;;/q;2*+1/p-2.
What are the key properties of dipotassium;2-tert-butylbenzene-1,4-diolate?
dipotassium;2-tert-butylbenzene-1,4-diolate has a molecular weight of 242.40 g/mol, XLogP of -4.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-tert-butylbenzene-1,4-diolate is sourced from PubChem (CID 139035525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).