About 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione
3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione (PubChem CID 139035818) has the molecular formula C16H8F2N4O2
and a molecular weight of 326.26 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione.
Molecular Properties
| Compound Name | 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione |
| PubChem CID | 139035818 |
| Molecular Formula | C16H8F2N4O2 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione |
| SMILES | O=C1c2cccnc2C(=O)c2c1nnn2Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H8F2N4O2/c17-9-4-8(5-10(18)6-9)7-22-14-13(20-21-22)15(23)11-2-1-3-19-12(11)16(14)24/h1-6H,7H2 |
| InChIKey | RKNOLQYMOZIFNV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione?
The IUPAC name of 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione (CID 139035818) is 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione.
What is the SMILES notation for 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione?
The canonical SMILES for 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione is O=C1c2cccnc2C(=O)c2c1nnn2Cc1cc(F)cc(F)c1.
What is the InChIKey of 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione?
The InChIKey is RKNOLQYMOZIFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F2N4O2/c17-9-4-8(5-10(18)6-9)7-22-14-13(20-21-22)15(23)11-2-1-3-19-12(11)16(14)24/h1-6H,7H2.
What are the key properties of 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione?
3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione has a molecular weight of 326.26 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-difluorophenyl)methyl]triazolo[4,5-g]quinoline-4,9-dione is sourced from PubChem (CID 139035818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).