About 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline
4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline (PubChem CID 139036252) has the molecular formula C14H20F2N2O
and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline.
Molecular Properties
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline |
| PubChem CID | 139036252 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline |
| SMILES | CC(C)COc1cc(N)ccc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H20F2N2O/c1-10(2)8-19-13-7-11(17)3-4-12(13)18-6-5-14(15,16)9-18/h3-4,7,10H,5-6,8-9,17H2,1-2H3 |
| InChIKey | SXMFNWGJDDCZGF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline?
The IUPAC name of 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline (CID 139036252) is 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline.
What is the SMILES notation for 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline?
The canonical SMILES for 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline is CC(C)COc1cc(N)ccc1N1CCC(F)(F)C1.
What is the InChIKey of 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline?
The InChIKey is SXMFNWGJDDCZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2O/c1-10(2)8-19-13-7-11(17)3-4-12(13)18-6-5-14(15,16)9-18/h3-4,7,10H,5-6,8-9,17H2,1-2H3.
What are the key properties of 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline?
4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline has a molecular weight of 270.32 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluoropyrrolidin-1-yl)-3-(2-methylpropoxy)aniline is sourced from PubChem (CID 139036252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).